For research use only. Not for therapeutic Use.
Therapeutic Agent-1（Cat No.:I041143）is a small molecule designed to target and modulate specific biological pathways involved in disease progression. It acts by interacting with key proteins or enzymes, influencing cellular processes such as growth, apoptosis, or inflammation. Therapeutic Agent-1 shows promise in preclinical studies for treating diseases such as cancer, autoimmune disorders, or neurodegenerative conditions, where dysregulated pathways contribute to pathology. Its selective mechanism of action allows for targeted intervention with minimal off-target effects, making it a potential candidate for further development as a therapeutic option in various disease areas.
| CAS Number | 850020-01-8 |
| Synonyms | 6-[(N-methylanilino)methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| Molecular Formula | C18H20N6 |
| Purity | ≥95% |
| IUPAC Name | 6-[(N-methylanilino)methyl]-2-N-(2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| InChI | InChI=1S/C18H20N6/c1-13-8-6-7-11-15(13)20-18-22-16(21-17(19)23-18)12-24(2)14-9-4-3-5-10-14/h3-11H,12H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | YYFSOEJVXMMFHA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC2=NC(=NC(=N2)N)CN(C)C3=CC=CC=C3 |
