For research use only. Not for therapeutic Use.
Thiacetazone(Cat No.:M067551)is an anti-tuberculosis drug, primarily used as an adjunct therapy for multidrug-resistant tuberculosis (MDR-TB). It is a synthetic compound with bacteriostatic properties, inhibiting the growth of Mycobacterium tuberculosis. Thiacetazone is often utilized when first-line drugs fail or in combination with other medications in resistant cases. Its mechanism of action involves interference with cellular processes in the bacteria, though its exact pathway remains less well-defined. Despite its efficacy, Thiacetazone is associated with potential adverse effects, including hepatotoxicity, which requires monitoring during treatment.
CAS Number | 104-06-3 |
Molecular Formula | C10H12N4OS |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | N-[4-[(E)-(carbamothioylhydrazinylidene)methyl]phenyl]acetamide |
InChI | InChI=1S/C10H12N4OS/c1-7(15)13-9-4-2-8(3-5-9)6-12-14-10(11)16/h2-6H,1H3,(H,13,15)(H3,11,14,16)/b12-6+ |
InChIKey | SRVJKTDHMYAMHA-WUXMJOGZSA-N |
SMILES | CC(=O)NC1=CC=C(C=C1)/C=N/NC(=S)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |