For research use only. Not for therapeutic Use.
Thiamine diphosphate analog 1(Cat No.:I018964) is a derivative of thiamine diphosphate, which is the biologically active form of vitamin B1. Thiamine diphosphate serves as a crucial cofactor involved in various cellular pathways, particularly those related to energy metabolism and the synthesis of key molecules such as nucleic acids and neurotransmitters. Analog 1 may have been designed to modify the properties or interactions of thiamine diphosphate, potentially leading to altered enzymatic activity or specific targeting of cellular processes.
CAS Number | 2606-90-8 |
Molecular Formula | C₆H₁₁NO₇P₂S |
Purity | ≥95% |
Storage | Hygroscopic, -20°C Freezer, Under inert atmosphere |
IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl phosphono hydrogen phosphate |
InChI | InChI=1S/C6H11NO7P2S/c1-5-6(17-4-7-5)2-3-13-16(11,12)14-15(8,9)10/h4H,2-3H2,1H3,(H,11,12)(H2,8,9,10) |
InChIKey | UFUUMZHATZTWCW-UHFFFAOYSA-N |
SMILES | CC1=C(SC=N1)CCOP(=O)(O)OP(=O)(O)O |
Reference | [1]. Tomita I, et al. Coenzyme analogue inhibition in the reconstitution of yeast pyruvate decarboxylase and transketolase. Biochem Biophys Res Commun. 1974 Mar 15;57(1):78-84.<br>[2]. Kowalska E, et al. Altered expression and activities of enzymes involved in thiamine diphosphate biosynthesis in Saccharomyces cerevisiae under oxidative and osmotic stress. FEMS Yeast Res. 2012 Aug;12(5):534-46. |