For research use only. Not for therapeutic Use.
Thiamine Disulfide Hydrate(Cat No.:R058652)is a stable, water-soluble compound commonly used in pharmaceutical and biochemical research. As a derivative of thiamine (vitamin B1), it plays a role in various metabolic pathways, particularly in the synthesis of coenzymes involved in carbohydrate metabolism. This compound is typically employed in studies focused on thiamine metabolism, enzyme interactions, and the effects of thiamine deficiency. Its stable nature and solubility make it a valuable tool in research settings, contributing to a better understanding of metabolic disorders and the therapeutic potential of vitamin B1 derivatives.
CAS Number | 67-16-3 |
Synonyms | N,N’-[Dithiobis[2-(2-hydroxyethyl)-1-methyl-2,1-ethenediyl]]bis[N-[(4-amino-2-methyl-5-pyrimidinyl)methyl]formamide; Aktivin; Algoneurina; Alitia S; Aneurin Disulfide; Aneurine Disulfide; Apren S; Daiomin; Daisazin; Feidmin 5; Neolamin; SSB1; TDS; Th |
Molecular Formula | C₂₄H₃₄N₈O₄S₂ • xH₂O |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(E)-3-[[(E)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-hydroxypent-2-en-3-yl]disulfanyl]-5-hydroxypent-2-en-2-yl]formamide |
InChI | InChI=1S/C24H34N8O4S2/c1-15(31(13-35)11-19-9-27-17(3)29-23(19)25)21(5-7-33)37-38-22(6-8-34)16(2)32(14-36)12-20-10-28-18(4)30-24(20)26/h9-10,13-14,33-34H,5-8,11-12H2,1-4H3,(H2,25,27,29)(H2,26,28,30)/b21-15+,22-16+ |
InChIKey | GFEGEDUIIYDMOX-YHARCJFQSA-N |
SMILES | CC1=NC=C(C(=N1)N)CN(/C(=C(/SS/C(=C(/N(C=O)CC2=CN=C(N=C2N)C)\C)/CCO)\CCO)/C)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |