For research use only. Not for therapeutic Use.
Thidiazuron (TDZ) is a plant growth regulator and cytokinin-like compound used to promote plant growth and development. It stimulates cell division and differentiation, leading to enhanced shoot formation and lateral branching in plants. Thidiazuron is effective at low concentrations and is used in tissue culture techniques for micropropagation and somatic embryogenesis. It is also employed in agriculture to increase fruit set and yield in crops. Thidiazuron’s mode of action involves altering plant hormone levels, influencing various physiological processes.
| CAS Number | 51707-55-2 |
| Synonyms | N-Phenyl-N’-1,2,3-thiadiazol-5-ylurea; 1-Phenyl-3-(1,2,3-thiadiazol-5-yl)urea; Avguron; CCG-24904; Dropp; Dropp SC; Lift; N-Phenyl-N’-1,2,3-thiadiazol-5-ylurea; SN 49537; TAG; TAG (plant growth regulator); TDZ; |
| Molecular Formula | C9H8N4OS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-phenyl-3-(thiadiazol-5-yl)urea |
| InChI | InChI=1S/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) |
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CN=NS2 |
| Reference | Schulze J., Improvements in Cereal Tissue Culture by Thidiazuron: A Review, Fruit, Vegetable and Cereal Science and Biotechnology, Vol. 1(2), pp. 64-79, 2007.</span></p> |
