For research use only. Not for therapeutic Use.
Thiencarbazone-methyl (Cat. No: R036358) is a heterocyclic compound that can be used as an insecticide to control weeds in corn plantations.
| Catalog Number | R036358 |
| CAS Number | 317815-83-1 |
| Synonyms | 4-[[[(4,5-Dihydro-3-methoxy-4-methyl-5-oxo-1H-1,2,4-triazol-1-yl)carbonyl]amino]sulfonyl]-5-methyl-3-Thiophenecarboxylic Acid Methyl Ester; |
| Molecular Formula | C12H14N4O7S2 |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | methyl 4-[(3-methoxy-4-methyl-5-oxo-1,2,4-triazole-1-carbonyl)sulfamoyl]-5-methylthiophene-3-carboxylate |
| InChI | InChI=1S/C12H14N4O7S2/c1-6-8(7(5-24-6)9(17)22-3)25(20,21)14-10(18)16-12(19)15(2)11(13-16)23-4/h5H,1-4H3,(H,14,18) |
| InChIKey | XSKZXGDFSCCXQX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CS1)C(=O)OC)S(=O)(=O)NC(=O)N2C(=O)N(C(=N2)OC)C |
