For research use only. Not for therapeutic Use.
Thioaildenafil is an analog of sildenafil, a medication used to treat erectile dysfunction. Thioaildenafil is an unauthorized and potentially dangerous compound found in certain dietary supplements marketed for sexual enhancement. It poses health risks due to its similarity to sildenafil and potential interactions with other medications. Regulatory agencies warn against its use due to undisclosed ingredients and lack of safety data.
| Catalog Number | R048430 |
| CAS Number | 856190-47-1 |
| Synonyms | (3R,5S)-rel-1-[[3-(4,7-Dihydro-1-methyl-3-propyl-7-thioxo-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-4-ethoxyphenyl]sulfonyl]-3,5-dimethyl-piperazine; Sulfoaildenafil; |
| Molecular Formula | C23H32N6O3S2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-[5-[(3S,5R)-3,5-dimethylpiperazin-1-yl]sulfonyl-2-ethoxyphenyl]-1-methyl-3-propyl-4H-pyrazolo[4,3-d]pyrimidine-7-thione |
| InChI | InChI=1S/C23H32N6O3S2/c1-6-8-18-20-21(28(5)27-18)23(33)26-22(25-20)17-11-16(9-10-19(17)32-7-2)34(30,31)29-12-14(3)24-15(4)13-29/h9-11,14-15,24H,6-8,12-13H2,1-5H3,(H,25,26,33)/t14-,15+ |
| InChIKey | SCLUKEPFXXPARW-GASCZTMLSA-N |
| SMILES | CCCC1=NN(C2=C1NC(=NC2=S)C3=C(C=CC(=C3)S(=O)(=O)N4CC(NC(C4)C)C)OCC)C |
