For research use only. Not for therapeutic Use.
Thiobencarb (Cat.No:R063509) is a selective herbicide widely used in rice cultivation to control grassy and broadleaf weeds. Its mode of action involves inhibiting photosynthesis in susceptible plants. Thiobencarb plays a crucial role in weed management strategies, helping to enhance crop yield and quality in rice farming while minimizing environmental impact.
CAS Number | 28249-77-6 |
Synonyms | N,N-Diethyl-carbamothioic acid S-[(4-chlorophenyl)methyl] ester;?Diethylthio-carbamic acid S-(p-chlorobenzyl) ester; Diethyl-carbamothioic acid S-[(4-chlorophenyl)methyl] Ester; p-Chloro-α-toluenethiol Diethylcarbamate; B 3015; B 3015 (pesticide); Be |
Molecular Formula | C12H16ClNOS |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate |
InChI | InChI=1S/C12H16ClNOS/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10/h5-8H,3-4,9H2,1-2H3 |
InChIKey | QHTQREMOGMZHJV-UHFFFAOYSA-N |
SMILES | CCN(CC)C(=O)SCC1=CC=C(C=C1)Cl |