For research use only. Not for therapeutic Use.
Thiopropionic acid(Cat No.:M120179)is an organosulfur compound characterized by its three-carbon chain ending in a thiol (-SH) group. It serves as a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and polymers. Its reactivity makes it suitable for creating thioester bonds, essential in peptide synthesis and biochemical research. Thiopropionic acid’s ability to chelate metals also finds applications in industrial processes, such as metal surface treatment and corrosion inhibition. Its versatile nature and utility in various chemical reactions underscore its importance in both research and industrial applications.
CAS Number | 1892-31-5 |
Synonyms | Propanethioic acid |
Molecular Formula | C3H6OS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | propanethioic S-acid |
InChI | InChI=1S/C3H6OS/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
InChIKey | KOODSCBKXPPKHE-UHFFFAOYSA-N |
SMILES | CCC(=O)S |