For research use only. Not for therapeutic Use.
A thioridazine-d3 hydrochloride（Cat No.:S000358） is a deuterated form of thioridazine hydrochloride, where three hydrogen atoms are replaced with deuterium. Thioridazine is an antipsychotic medication primarily used to treat schizophrenia and other psychotic disorders. The deuteration of thioridazine enhances its chemical stability, facilitating more accurate and detailed pharmacokinetic and metabolic studies. This isotopic labeling helps researchers track the drug’s behavior in the body with greater precision, which is crucial for understanding its mechanism of action, optimizing therapeutic dosages, and minimizing potential side effects, thereby improving safety and effectiveness in clinical use.
| Catalog Number | S000358 |
| CAS Number | 1189928-36-6 |
| Molecular Formula | C21H24D3ClN2S2 |
| Purity | ≥95% |
| IUPAC Name | 2-methylsulfanyl-10-[2-[1-(trideuteriomethyl)piperidin-2-yl]ethyl]phenothiazine;hydrochloride |
| InChI | InChI=1S/C21H26N2S2.ClH/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23;/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3;1H/i1D3; |
| InChIKey | NZFNXWQNBYZDAQ-NIIDSAIPSA-N |
| SMILES | CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)SC.Cl |
