For research use only. Not for therapeutic Use.
Thioridazine Hydrochloride (Cat.No:I001170) is an antipsychotic medication used to treat schizophrenia and other psychotic disorders. It works by blocking dopamine receptors in the brain, alleviating symptoms of hallucinations, delusions, and disorganized thinking. Thioridazine Hydrochloride may also have other therapeutic applications, such as in the treatment of bipolar disorder and certain behavioral problems.
| Catalog Number | I001170 |
| CAS Number | 130-61-0 |
| Synonyms | Aldazine;Mellaril |
| Molecular Formula | C₂₁H₂₆N₂S₂.HCl |
| Purity | ≥95% |
| Solubility | DMSO:45mg/mL |
| Storage | -20°C |
| InChI | InChI=1S/C21H26N2S2.ClH/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23;/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3;1H |
| InChIKey | NZFNXWQNBYZDAQ-UHFFFAOYSA-N |
| SMILES | CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)SC.Cl |
| Reference | <p style=/line-height:25px/> |
