For research use only. Not for therapeutic Use.
Thiosemicarbazide hydrochloride is a white crystalline compound and a derivative of thiosemicarbazide, known for its broad range of biological activities. This compound serves as a versatile building block in organic synthesis and medicinal chemistry, often utilized in the development of pharmaceuticals, including anticancer and antimicrobial agents. Its thiol group enhances its reactivity, making it suitable for various chemical transformations. Thiosemicarbazide hydrochloride’s unique properties allow it to act as a ligand in coordination chemistry and as an intermediate in drug formulation.
CAS Number | 4346-94-5 |
Molecular Formula | CH6ClN3S |
Purity | ≥95% |
IUPAC Name | aminothiourea;hydrochloride |
InChI | InChI=1S/CH5N3S.ClH/c2-1(5)4-3;/h3H2,(H3,2,4,5);1H |
InChIKey | LEHOGBUBQSGCOK-UHFFFAOYSA-N |
SMILES | C(=S)(N)NN.Cl |