For research use only, not for therapeutic use.
Thiosemicarbazide(CAT: R019090) is an organic compound with a sulfur atom and a hydrazine group. Its mode of action involves being a versatile chemical building block and an important intermediate in organic synthesis. Pharmacologically, thiosemicarbazide is not used as a therapeutic drug on its own. Instead, it finds various applications in the preparation of pharmaceuticals, agrochemicals, and other biologically active compounds. Thiosemicarbazide and its derivatives have shown potential antimicrobial, antiviral, and antitumor activities in preclinical studies.
| Catalog Number | R019090 |
| CAS Number | 79-19-6 |
| Synonyms | 1-Amino-2-thiourea; 1-Aminothiourea; 2-Thiosemicarbazide; Aminohydrazinomethane-1-thione; Aminothiourea; Isothiosemicarbazide; N-Aminothiourea; NSC 2213; NSC 31792; TSC; TSZ; Thiasemicarbazide; Thiocarbamoylhydrazine; Thiosemicarbazide |
| Molecular Formula | CH5N3S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | aminothiourea |
| InChI | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
| InChIKey | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
| SMILES | C(=S)(N)NN |
