For research use only. Not for therapeutic Use.
Thiosemicarbazide(Cat No.:R019090)is a versatile sulfur-containing organic compound widely utilized in chemical, pharmaceutical, and materials research. It serves as a key reagent in the synthesis of heterocyclic compounds, including thiosemicarbazones, which exhibit antimicrobial, antiviral, and anticancer properties. Its reactivity with carbonyl groups makes it valuable for forming Schiff bases, studying coordination chemistry, and designing metal complexes with biological activity. Thiosemicarbazide is also explored for its potential in material science applications, such as corrosion inhibitors and polymer modification, showcasing its significance in advancing diverse fields of scientific research.
CAS Number | 79-19-6 |
Synonyms | 1-Amino-2-thiourea; 1-Aminothiourea; 2-Thiosemicarbazide; Aminohydrazinomethane-1-thione; Aminothiourea; Isothiosemicarbazide; N-Aminothiourea; NSC 2213; NSC 31792; TSC; TSZ; Thiasemicarbazide; Thiocarbamoylhydrazine; Thiosemicarbazide |
Molecular Formula | CH5N3S |
Purity | ≥95% |
Target | Orthopoxvirus |
Storage | -20°C |
IUPAC Name | aminothiourea |
InChI | InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
InChIKey | BRWIZMBXBAOCCF-UHFFFAOYSA-N |
SMILES | C(=S)(N)NN |