For research use only. Not for therapeutic Use.
(-)-Thujone Tech（Cat No.:M047641）is a naturally occurring monoterpene found in essential oils of various plants, such as wormwood and sage. Known for its distinctive aroma, it plays a significant role in the fragrance and flavor industries. In research, (-)-Thujone is studied for its biological activities, including potential antimicrobial, antifungal, and neurotoxic effects. It is also a subject of interest in the study of traditional herbal remedies and the pharmacological properties of absinthe. Its technical grade ensures suitability for industrial applications and experimental purposes.
| CAS Number | 1125-12-8 |
| Molecular Formula | C10H16O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one |
| InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | USMNOWBWPHYOEA-UHFFFAOYSA-N |
| SMILES | CC1C2CC2(CC1=O)C(C)C |
