For research use only. Not for therapeutic Use.
(-)-Thujone Tech(Cat No.:M047641)is a naturally occurring monoterpene found in essential oils of various plants, such as wormwood and sage. Known for its distinctive aroma, it plays a significant role in the fragrance and flavor industries. In research, (-)-Thujone is studied for its biological activities, including potential antimicrobial, antifungal, and neurotoxic effects. It is also a subject of interest in the study of traditional herbal remedies and the pharmacological properties of absinthe. Its technical grade ensures suitability for industrial applications and experimental purposes.
Catalog Number | M047641 |
CAS Number | 1125-12-8 |
Molecular Formula | C10H16O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one |
InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3 |
InChIKey | USMNOWBWPHYOEA-UHFFFAOYSA-N |
SMILES | CC1C2CC2(CC1=O)C(C)C |