For research use only. Not for therapeutic Use.
Thymidine is a pyrimidine nucleoside that is composed of the pyrimidine base thymine attached to the sugar deoxyribose. As a constituent of DNA, thymidine pairs with adenine in the DNA double helix. In cell biology it is used to synchronize the cells in G<sub>1</sub>/early S phase.
| Catalog Number | R014550 |
| CAS Number | 50-89-5 |
| Synonyms | 2’-deoxy Thymidine;2’-deoxy-5-methyl-Uridine;5-Methyldeoxyuridine;NSC 21548;Thymine deoxyriboside |
| Molecular Formula | C10H14N2O5 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Room temperature |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m0/s1 |
| InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O |
