For research use only. Not for therapeutic Use.
Thymine-d3 is a deuterated form of thymine, a pyrimidine base found in DNA. In thymine-d3, three hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen, typically at the methyl group (position 5). This isotope labeling makes thymine-d3 valuable in biochemical research, particularly in studying DNA synthesis, repair mechanisms, and enzyme interactions. The use of deuterium allows for precise tracking in mass spectrometry and NMR studies, aiding in understanding the dynamics of DNA-related processes.
| Catalog Number | R004625 |
| CAS Number | 68941-98-0 |
| Synonyms | 5-(Methyl-d3)-2,4(1H,3H)-pyrimidinedione; NSC 14705-d3; NSC 1686634-d3; 4-Hydroxy-5-(methyl-d3)pyrimidin-2(1H)-one; 5-Methyluracil-d3; |
| Molecular Formula | C5H6N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-(trideuteriomethyl)-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)/i1D3 |
| InChIKey | RWQNBRDOKXIBIV-FIBGUPNXSA-N |
| SMILES | CC1=CNC(=O)NC1=O |
