For research use only. Not for therapeutic Use.
Thymol iodide（Cat No.:I017305）is a versatile iodinated compound used primarily in pharmaceutical and biochemical research. It is commonly employed in the synthesis of bioactive molecules and as a reagent in chemical reactions. Its distinct iodine functionality makes it an important tool in the study of molecular interactions and the development of iodine-containing compounds. Thymol iodide is utilized in various experimental applications, including its use in the synthesis of potential antimicrobial agents and other bioactive substances. Its stability and reactivity provide researchers with a reliable compound for advanced chemical investigations.
| Catalog Number | I017305 |
| CAS Number | 552-22-7 |
| Molecular Formula | C₂₀H₂₄I₂O₂ |
| Purity | ≥95% |
| Target | Fungal |
| IUPAC Name | [4-(4-iodooxy-2-methyl-5-propan-2-ylphenyl)-5-methyl-2-propan-2-ylphenyl] hypoiodite |
| InChI | InChI=1S/C20H24I2O2/c1-11(2)15-9-17(13(5)7-19(15)23-21)18-10-16(12(3)4)20(24-22)8-14(18)6/h7-12H,1-6H3 |
| InChIKey | SHOKWSLXDAIZPP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC(=C(C=C2C)OI)C(C)C)C(C)C)OI |
| Reference | [1]. Gupta PC. Use of Thymol Iodide in Interstitial Keratitis. Ind Med Gaz. 1931 May;66(5):267-268.<br>[2]. AshutoshSrivastava, A study on enrichment of the rotifer Brachionus “Cayman” with iodine from different sources. Aquaculture. 2012 Mar 7, 334-337:82-88. |
