For research use only. Not for therapeutic Use.
Thymol(Cat No.:R015864)is a naturally occurring monoterpene phenol, primarily found in thyme oil. Known for its antimicrobial, antifungal, and antioxidant properties, thymol is widely used in medicinal, cosmetic, and food preservation applications. It plays a role in soothing digestive issues, alleviating respiratory conditions, and exhibiting anti-inflammatory effects. In pharmaceutical research, thymol is studied for its potential as a natural preservative and therapeutic agent. Its unique chemical structure, featuring a hydroxyl group attached to a benzene ring, allows it to interact effectively with biological systems, offering diverse applications in health and wellness.
CAS Number | 89-83-8 |
Synonyms | 1-Methyl-3-hydroxy-4-isopropylbenzene; 2-Hydroxy-1-isopropyl-4-methylbenzene; 2-Isopropyl-5-methylphenol; 3-Hydroxy-p-cymene; 3-Methyl-6-isopropylphenol; 5-Methyl-2-(1-methylethyl)phenol; 5-Methyl-2-isopropyl-1-phenol; 5-Methyl-2-isopropylphenol; 6-I |
Molecular Formula | C10H14O |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 5-methyl-2-propan-2-ylphenol |
InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h4-7,11H,1-3H3 |
InChIKey | MGSRCZKZVOBKFT-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)C(C)C)O |