Thyodene(Amylodextrin) is a type of dextrin derived from the partial hydrolysis of starch. It consists of short chains of glucose molecules linked by alpha-1,4 glycosidic bonds, resulting in a mixture of oligosaccharides with varying chain lengths. Amylodextrin is commonly used in food industry as a thickening agent, stabilizer, or filler, and in pharmaceuticals as an excipient in tablet formulations due to its binding properties.
| Catalog Number | R070951 |
| CAS Number | 9005-84-9 |
| Synonyms | Amylodextrin |
| Molecular Formula | C12H22O11 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
