Thyroxine-13C6 is an isotopically labeled form of the thyroid hormone thyroxine, in which six carbon atoms are enriched with the stable carbon-13 isotope. This compound is pivotal in research focused on thyroid function, hormone regulation, and metabolic studies. The 13C labeling enables precise tracking and analysis in mass spectrometry and NMR spectroscopy, making it invaluable for understanding the metabolism, distribution, and interaction of thyroxine within biological systems. Researchers use Thyroxine-13C6 to explore the detailed mechanisms of thyroid hormone action, aiding in the development of more effective diagnostic tools and therapeutic strategies for thyroid-related disorders.
| Catalog Number | R009256 |
| CAS Number | 1217780-14-7 |
| Synonyms | O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine; (-)-Thyroxine; 3,3’,5,5’-Tetraiodo-L-thyronine; Henning; L-T4; L-Thyroxin; Levothyroxine; NSC 36397; T4; T4 (hormone); Thyrax; Thyreoideum; Thyroxin; Thyroxinal; |
| Molecular Formula | C15H11I4NO4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChI | InChI=1S/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1/i4+1,5+1,7+1,8+1,9+1,13+1 |
| InChIKey | XUIIKFGFIJCVMT-DOEZJOBUSA-N |
| SMILES | C1=C(C=C(C(=C1I)O[13C]2=[13CH][13C](=[13C]([13C](=[13CH]2)I)O)I)I)C[C@@H](C(=O)O)N |
