For research use only. Not for therapeutic Use.
Thyroxine methyl ester, also known as methyl thyroxine, is a synthetic derivative of thyroxine (T4), a hormone produced by the thyroid gland. This compound is modified by esterification, where a methyl group replaces a hydroxyl group on the thyroxine molecule. Thyroxine methyl ester is used in research to study thyroid hormone metabolism and function, as well as to explore potential therapeutic applications related to thyroid disorders. Its chemical structure mimics that of natural thyroid hormones, facilitating experimental investigations.
CAS Number | 32180-11-3 |
Synonyms | O-(4-Hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine Methyl Ester; L-Thyroxine Methyl Ester; |
Molecular Formula | C16H13I4NO4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | methyl (2S)-2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoate |
InChI | InChI=1S/C16H13I4NO4/c1-24-16(23)13(21)4-7-2-11(19)15(12(20)3-7)25-8-5-9(17)14(22)10(18)6-8/h2-3,5-6,13,22H,4,21H2,1H3/t13-/m0/s1 |
InChIKey | ZTSGDCMQRKBJKC-ZDUSSCGKSA-N |
SMILES | COC(=O)C(CC1=CC(=C(C(=C1)I)OC2=CC(=C(C(=C2)I)O)I)I)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |