For research use only. Not for therapeutic Use.
Tiazotic acid (CAT: I009807) is an antioxidant compound. Antioxidants play a crucial role in protecting cells from oxidative stress and damage caused by free radicals and reactive oxygen species. By neutralizing these harmful molecules, antioxidants help maintain cellular health and may have potential applications in various areas, including medicine, skincare, and food preservation. However, it’s important to note that the specific pharmacologic action and applications of Tiazotic acid may require further investigation and research to fully understand its potential benefits and limitations.
CAS Number | 64679-65-8 |
Synonyms | Tiazotic acid;2-((3-methyl-1H-1,2,4-triazol-5-yl)thio)acetic acid |
Molecular Formula | C5H7N3O2S |
Purity | ≥95% |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
InChI | InChI=1S/C5H7N3O2S/c1-3-6-5(8-7-3)11-2-4(9)10/h2H2,1H3,(H,9,10)(H,6,7,8) |
InChIKey | OJUNWHNRDPRNBR-UHFFFAOYSA-N |
SMILES | CC1=NC(=NN1)SCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |