For research use only. Not for therapeutic Use.
Tri-iso-butyl aluminum (TIBA)(Cat No.:R008505), is an organometallic compound used as a catalyst and co-catalyst in various chemical reactions, particularly in polymerization processes. It belongs to the class of aluminum alkyl compounds and is known for its Lewis acidic properties, which make it valuable in the production of polyolefins like polyethylene and polypropylene. TIBA can initiate the polymerization of olefins when combined with other catalysts and cocatalysts, enabling the synthesis of a wide range of plastics and elastomers. Its role in polymer chemistry contributes to the production of essential materials used in various industries.
CAS Number | 88-82-4 |
Synonyms | Triiodobenzoic acid; TIBA; 2, 3, 5-Triiodobenzoic acid; |
Molecular Formula | C7H3I3O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,5-triiodobenzoic acid |
InChI | InChI=1S/C7H3I3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
InChIKey | ZMZGFLUUZLELNE-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1I)I)C(=O)O)I |
Reference | 1: Guerrero JR, Garrido G, Acosta M, Sánchez-Bravo J. Influence of <br> 3: Kessler B, Bak R, Cohen A. Flowering in Fruit Trees and Annual Plants as |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |