For research use only. Not for therapeutic Use.
Ticarcillin disodium(Cat No.:I003626)is a broad-spectrum, beta-lactam antibiotic in the penicillin class, commonly used to treat serious gram-negative bacterial infections, including those caused by Pseudomonas aeruginosa. It works by inhibiting bacterial cell wall synthesis, leading to cell lysis and death. Ticarcillin is often combined with clavulanate, a beta-lactamase inhibitor, to enhance its effectiveness against beta-lactamase-producing bacteria. Administered intravenously, it is typically used in hospital settings for respiratory, urinary, and intra-abdominal infections. Its broad activity range makes Ticarcillin disodium valuable in managing complex and resistant infections.
CAS Number | 4697-14-7 |
Molecular Formula | C15H14N2Na2O6S2 |
Purity | ≥95% |
Target | Bacterial |
Solubility | DMSO:18mg/mL |
Storage | 2-8°C |
IUPAC Name | disodium;(2S,5R,6R)-6-[[(2R)-2-carboxylato-2-thiophen-3-ylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
InChI | InChI=1S/C15H16N2O6S2.2Na/c1-15(2)9(14(22)23)17-11(19)8(12(17)25-15)16-10(18)7(13(20)21)6-3-4-24-5-6;;/h3-5,7-9,12H,1-2H3,(H,16,18)(H,20,21)(H,22,23);;/q;2*+1/p-2/t7-,8-,9+,12-;;/m1../s1 |
InChIKey | ZBBCUBMBMZNEME-QBGWIPKPSA-L |
SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CSC=C3)C(=O)[O-])C(=O)[O-])C.[Na+].[Na+] |
Reference | <p style=/line-height:25px/> |