For research use only. Not for therapeutic Use.
Ticlopidine(Cat No.:L045121) is a thienopyridine derivative that acts as an antiplatelet agent. It inhibits platelet aggregation by irreversibly blocking the P2Y12 ADP receptor on platelet cell membranes, thereby reducing the risk of blood clot formation. This mechanism of action makes it valuable in the field of pharmaceuticals for preventing thrombotic events, especially in patients with a history of stroke, myocardial infarction, or peripheral artery disease. Additionally, ticlopidine may find applications in organic chemistry as a reference compound for designing new antiplatelet drugs or in material chemistry for drug formulation studies.
| Catalog Number | L045121 |
| CAS Number | 55142-85-3 |
| Molecular Formula | C14H14ClNS |
| Purity | ≥95% |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| InChI | InChI=1S/C14H14ClNS/c15-13-4-2-1-3-11(13)9-16-7-5-14-12(10-16)6-8-17-14/h1-4,6,8H,5,7,9-10H2 |
| InChIKey | PHWBOXQYWZNQIN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)CC3=CC=CC=C3Cl |
