For research use only. Not for therapeutic Use.
Tigecycline（Cat No.:A000675）is a broad-spectrum glycylcycline antibiotic effective against various gram-positive, gram-negative, and multidrug-resistant bacterial infections. It inhibits bacterial protein synthesis by binding to the 30S ribosomal subunit, blocking essential processes needed for bacterial growth. Tigecycline is often used to treat complicated infections, including skin, intra-abdominal, and pneumonia cases, especially those involving resistant strains like MRSA and VRE. Due to its efficacy against challenging infections, tigecycline plays a crucial role in addressing antibiotic resistance, making it valuable for both clinical treatment and research on resistant pathogens.
| Catalog Number | A000675 |
| CAS Number | 220620-09-7 |
| Synonyms | GAR-936 |
| Molecular Formula | C29H39N5O8 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | >29.3mg/mL in DMSO |
| Storage | 3 years -20C powder |
| Overview of Clinical Research | Tigecycline is an antibacterial by inhibiting mitochondrial protein. |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| InChI | InChI=1S/C29H39N5O8/c1-28(2,3)31-11-17(35)32-15-10-16(33(4)5)13-8-12-9-14-21(34(6)7)24(38)20(27(30)41)26(40)29(14,42)25(39)18(12)23(37)19(13)22(15)36/h10,12,14,21,31,36-37,40,42H,8-9,11H2,1-7H3,(H2,30,41)(H,32,35)/t12-,14-,21-,29-/m0/s1 |
| InChIKey | SOVUOXKZCCAWOJ-HJYUBDRYSA-N |
| SMILES | CC(C)(C)NCC(=O)NC1=CC(=C2C[C@H]3C[C@H]4[C@@H](C(=O)C(=C([C@]4(C(=O)C3=C(C2=C1O)O)O)O)C(=O)N)N(C)C)N(C)C |
| Reference | 1: Jha BK, Seo I, Kong HH, Suh SI, Suh MH, Baek WK. Tigecycline inhibits proliferation of Acanthamoeba castellanii. Parasitol Res. 2015 Mar;114(3):1189-95. doi: 10.1007/s00436-014-4302-1. Epub 2015 Jan 7. PubMed PMID: 25563616.<br /> |
