For research use only. Not for therapeutic Use.
Tigolaner is a GABA antagonist that regulates chloride channel. Tigolaner is an antiparasitic agent[1].
| Catalog Number | I015393 |
| CAS Number | 1621436-41-6 |
| Synonyms | 2-chloro-N-(1-cyanocyclopropyl)-5-[1-[2-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-3-yl]pyrazol-4-yl]benzamide |
| Molecular Formula | C21H13ClF8N6O |
| Purity | ≥95% |
| InChI | InChI=1S/C21H13ClF8N6O/c1-35-17(14(20(25,26)27)15(34-35)19(23,24)21(28,29)30)36-8-11(7-32-36)10-2-3-13(22)12(6-10)16(37)33-18(9-31)4-5-18/h2-3,6-8H,4-5H2,1H3,(H,33,37) |
| InChIKey | TVAJZOVLQZNNCJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(C(F)(F)F)(F)F)C(F)(F)F)N2C=C(C=N2)C3=CC(=C(C=C3)Cl)C(=O)NC4(CC4)C#N |
| Reference | [1]. The use ofstems in the selectionofInternationa Nonproprietary Names(INN)forpharmaceutical substances 2018 (Stem Book2018). |
