For research use only. Not for therapeutic Use.
Tilorone dihydrochloride（Cat No.:I002946）is a broad-spectrum antiviral agent that is taken orally and works by stimulating the production of interferon, a protein that helps the body’s immune system fight against viral infections. In addition to its antiviral properties, tilorone dihydrochloride also exhibits antitumor and anti-inflammatory activities. It is known for its ability to inhibit the growth of certain tumors and reduce inflammation. Tilorone dihydrochloride represents a versatile therapeutic option with potential applications in the treatment of viral infections, cancer, and inflammatory conditions.
| Catalog Number | I002946 |
| CAS Number | 27591-69-1 |
| Synonyms | NSC 143969 |
| Molecular Formula | C25H34N2O3 • 2HCl |
| Purity | ≥95% |
| Solubility | H2O: ≥ 28 mg/mL |
| Storage | Room Temperature |
| IUPAC Name | 2,7-bis[2-(diethylamino)ethoxy]fluoren-9-one;dihydrochloride |
| InChI | InChI=1S/C25H34N2O3.2ClH/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19;;/h9-12,17-18H,5-8,13-16H2,1-4H3;2*1H |
| InChIKey | BSVYJQAWONIOOU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC1=CC2=C(C=C1)C3=C(C2=O)C=C(C=C3)OCCN(CC)CC.Cl.Cl |
| Reference | <p style=/line-height:25px/> |
