For research use only. Not for therapeutic Use.
Timonacic (CAt: I013040) has been used as an adjuvant in the treatment of acute and hepatic disorders. Its immunomodulatory properties can assist in supporting the immune response and promoting healing in these conditions. Additionally, Timonacic has been explored for its potential in the treatment of certain cancer cases, specifically in inducing reverse transformation. Reverse transformation refers to the reversion of cancer cells to a more normal or less malignant state. Further research is needed to fully understand the mechanisms and efficacy of Timonacic in cancer treatment.
| Catalog Number | I013040 |
| CAS Number | 444-27-9 |
| Molecular Formula | C₄H₇NO₂S |
| Purity | ≥95% |
| Target | Others |
| Solubility | DMSO: 6 mg/mL (Need ultrasonic) |
| IUPAC Name | 1,3-thiazolidine-4-carboxylic acid |
| InChI | InChI=1S/C4H7NO2S/c6-4(7)3-1-8-2-5-3/h3,5H,1-2H2,(H,6,7) |
| InChIKey | DZLNHFMRPBPULJ-UHFFFAOYSA-N |
| SMILES | C1C(NCS1)C(=O)O |
| Reference | [1]. Bakry RS, et al. Spectrophotometric investigation of the formed chelate between timonacic and palladium(II) and its analytical applications. J Pharm Biomed Anal. 1998 May;17(1):95-101. |
