For research use only. Not for therapeutic Use.
Tin (II) acetylacetonate(Cat No.:M079516), also known as stannous acetylacetonate, is a chemical compound with the formula Sn(C5H7O2)2. It involves the coordination of tin in a +2 oxidation state with two acetylacetonate ligands, which are a type of β-detonate. This compound is often used as a precursor in the synthesis of other tin compounds and as a catalyst in organic reactions. Its applications extend to materials science, particularly in the production of ceramics and as a stabilizer in PVC and other polymers, due to its ability to inhibit degradation processes.
CAS Number | 16009-86-2 |
Molecular Formula | C10H14O4Sn |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | bis[[(Z)-4-oxopent-2-en-2-yl]oxy]tin |
InChI | InChI=1S/2C5H8O2.Sn/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
InChIKey | XDRPDDZWXGILRT-FDGPNNRMSA-L |
SMILES | CC(=CC(=O)C)O[Sn]OC(=CC(=O)C)C |