For research use only. Not for therapeutic Use.
Tinlorafenib（Cat No.:I043363）is a small-molecule inhibitor that targets specific receptor tyrosine kinases (RTKs), including VEGFR and PDGFR, which are involved in angiogenesis, tumor growth, and metastasis. By inhibiting these kinases, tinlorafenib disrupts the signaling pathways responsible for the formation of new blood vessels that supply tumors with nutrients and oxygen. This mechanism makes it a promising candidate for cancer therapy, particularly for solid tumors such as lung, breast, and colorectal cancers. Ongoing preclinical and clinical studies aim to assess its efficacy, safety, and potential use in combination therapies for cancer treatment.
| CAS Number | 2573781-75-4 |
| Synonyms | N-[2-chloro-3-[(3,5-dimethyl-4-oxoquinazolin-6-yl)amino]-4-fluorophenyl]-3-fluoropropane-1-sulfonamide |
| Molecular Formula | C19H19ClF2N4O3S |
| Purity | ≥95% |
| IUPAC Name | N-[2-chloro-3-[(3,5-dimethyl-4-oxoquinazolin-6-yl)amino]-4-fluorophenyl]-3-fluoropropane-1-sulfonamide |
| InChI | InChI=1S/C19H19ClF2N4O3S/c1-11-13(6-7-14-16(11)19(27)26(2)10-23-14)24-18-12(22)4-5-15(17(18)20)25-30(28,29)9-3-8-21/h4-7,10,24-25H,3,8-9H2,1-2H3 |
| InChIKey | VVLVISDSGRHLMB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1C(=O)N(C=N2)C)NC3=C(C=CC(=C3Cl)NS(=O)(=O)CCCF)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
