Tiopronin-13C,d3 is a labeled version of tiopronin, a drug used primarily to reduce cystine levels in the urine for the treatment of cystinuria. In this compound, the carbon-13 isotope replaces a carbon atom, and three hydrogen atoms are replaced with deuterium. This dual isotopic labeling is useful in detailed pharmacokinetic and metabolic studies, particularly in mass spectrometry and NMR spectroscopy. Tiopronin-13C,d3 allows for precise tracking and analysis of the drug’s behavior in biological systems while retaining its therapeutic properties.
| Catalog Number | R006821 |
| CAS Number | 1189695-13-3 |
| Synonyms | N-(2-Mercapto-1-oxopropyl)glycine-13C,d3; N-(2-Mercaptopropionyl)glycine-13C,d3; Acadione-13C,d3; Capen-13C,d3; Captimer-13C,d3; Epatiol-13C,d3; Hepadigest-13C,d3; Meprin-13C,d3; Mucolysin-13C,d3; Sutilan-13C,d3; Thiolpropionamidoacetic Acid-13C,d3; |
| Molecular Formula | C5H9NO3S |
| Purity | 0% |
| Storage | Store at RT |
| IUPAC Name | 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid |
| InChI | InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)/i1D3,2+1 |
| InChIKey | YTGJWQPHMWSCST-HZPPXAECSA-N |
| SMILES | CC(C(=O)NCC(=O)O)S |
