For research use only. Not for therapeutic Use.
Titanium oxalate(Cat No.:M061356), with the chemical formula Ti(C2O4)2, is a coordination compound where titanium is complexed with the oxalate ion, a bidentate ligand. This compound is often encountered in its hydrated form, exhibiting properties typical of oxalate complexes such as good solubility in water and strong coordination abilities. Titanium oxalate is used primarily in the fields of materials science and chemistry for various applications, including the synthesis of titanium dioxide nanoparticles and as a precursor for other titanium-based materials. Its uses extend to dyeing processes, where it acts as a mordant.
CAS Number | 14677-00-0 |
Synonyms | TITANIUM OXALATE |
Molecular Formula | C4O8Ti |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | oxalate;titanium(4+) |
InChI | InChI=1S/2C2H2O4.Ti/c2*3-1(4)2(5)6;/h2*(H,3,4)(H,5,6);/q;;+4/p-4 |
InChIKey | BBJSDUUHGVDNKL-UHFFFAOYSA-J |
SMILES | C(=O)(C(=O)[O-])[O-].C(=O)(C(=O)[O-])[O-].[Ti+4] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |