For research use only. Not for therapeutic Use.
TJ191 (Cat.No:I037336) is a small molecule compound under investigation for its potential therapeutic applications, particularly in the field of oncology. It has been studied for its ability to inhibit specific signaling pathways involved in tumor growth and metastasis. TJ191 is believed to target key proteins associated with cancer cell survival, promoting cell death and reducing tumor progression. Though research is still in early stages, TJ191 shows promise as a potential cancer treatment, especially for tumors that are resistant to conventional therapies.
| Catalog Number | I037336 |
| CAS Number | 1522415-97-9 |
| Synonyms | TJ191; TJ-191; TJ 191 |
| Molecular Formula | C13H21NO2S |
| Purity | 98% |
| Target | Apoptosis |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-Amino-3-methylcarboxy-5-heptyl-thiophene |
| InChI | InChI=1S/C13H21NO2S/c1-3-4-5-6-7-8-10-9-11(12(14)17-10)13(15)16-2/h9H,3-8,14H2,1-2H3 |
| InChIKey | HUFNXSPJUAHQHP-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1=CC(C(OC)=O)=C(N)S1 |
