For research use only. Not for therapeutic Use.
TKIM (Cat No.:I037340) refers to a class of compounds that selectively inhibit kinases involved in T-cell activation and immune responses. These inhibitors target specific signaling pathways critical for T-cell function, which can be beneficial in modulating immune-related diseases such as autoimmune disorders, chronic inflammation, and organ transplant rejection. TKIMs are being investigated for their potential to selectively suppress harmful immune responses while preserving protective immunity, offering a targeted approach for treating conditions like rheumatoid arthritis, lupus, and other immune-mediated diseases with fewer side effects.
| CAS Number | 326921-25-9 |
| Synonyms | 4-chloro-N’-(2-quinolin-2-ylsulfanylacetyl)benzohydrazide |
| Molecular Formula | C18H14ClN3O2S |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-N'-(2-quinolin-2-ylsulfanylacetyl)benzohydrazide |
| InChI | InChI=1S/C18H14ClN3O2S/c19-14-8-5-13(6-9-14)18(24)22-21-16(23)11-25-17-10-7-12-3-1-2-4-15(12)20-17/h1-10H,11H2,(H,21,23)(H,22,24) |
| InChIKey | BWTKIGGLLXUFSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)SCC(=O)NNC(=O)C3=CC=C(C=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
