For research use only. Not for therapeutic Use.
TL4-12（Cat No.:I037346）is a novel, selective inhibitor designed to target specific proteins involved in cell signaling and immune response regulation. It works by modulating immune cell activity, particularly in the context of inflammatory diseases and certain cancers. By blocking key pathways that promote inflammation or tumor growth, TL4-12 has shown promise in preclinical studies for treating conditions like autoimmune disorders and cancer. Its ability to selectively target these pathways without broad immune suppression positions TL4-12 as a potential therapeutic candidate in both oncology and immunology, with ongoing research focusing on its clinical development.
| CAS Number | 1620820-12-3 |
| Synonyms | 4-methyl-3-[6-(methylamino)pyrimidin-4-yl]oxy-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| Molecular Formula | C25H27F3N6O2 |
| Purity | ≥95% |
| IUPAC Name | 4-methyl-3-[6-(methylamino)pyrimidin-4-yl]oxy-N-[3-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| InChI | InChI=1S/C25H27F3N6O2/c1-16-4-5-17(10-21(16)36-23-14-22(29-2)30-15-31-23)24(35)32-19-11-18(25(26,27)28)12-20(13-19)34-8-6-33(3)7-9-34/h4-5,10-15H,6-9H2,1-3H3,(H,32,35)(H,29,30,31) |
| InChIKey | HXKJJIMUMNPQQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)N3CCN(CC3)C)OC4=NC=NC(=C4)NC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
