For research use only. Not for therapeutic Use.
TL4830031（Cat No.:I043350）is a small-molecule inhibitor designed to target specific signaling pathways involved in cancer cell proliferation and survival. It primarily functions by inhibiting key kinases that regulate the cell cycle and apoptosis. Preclinical studies have demonstrated that TL4830031 can effectively suppress tumor growth in various cancer models, particularly in solid tumors and hematological cancers. By disrupting critical cellular processes, TL4830031 enhances the sensitivity of cancer cells to chemotherapy and radiation, making it a promising candidate for combination therapies. Ongoing research is focused on evaluating its safety, efficacy, and potential clinical applications.
| CAS Number | 2084107-15-1 |
| Synonyms | N-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-3-fluorophenyl]-7-fluoro-8-(4-hydroxypiperidin-1-yl)-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide |
| Molecular Formula | C35H33F2N5O6 |
| Purity | ≥95% |
| IUPAC Name | N-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-3-fluorophenyl]-7-fluoro-8-(4-hydroxypiperidin-1-yl)-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxamide |
| InChI | InChI=1S/C35H33F2N5O6/c1-18-4-6-21-31-23(13-26(37)32(21)41-10-8-20(43)9-11-41)33(44)24(16-42(18)31)34(45)40-19-5-7-28(25(36)12-19)48-35-22-14-29(46-2)30(47-3)15-27(22)38-17-39-35/h5,7,12-18,20,43H,4,6,8-11H2,1-3H3,(H,40,45) |
| InChIKey | SRXCPBOKWGKZRP-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2N4CCC(CC4)O)F)C(=O)NC5=CC(=C(C=C5)OC6=NC=NC7=CC(=C(C=C76)OC)OC)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
