For research use only. Not for therapeutic Use.
TLR8 Agonist 5（Cat No.:I042625）is a selective compound that targets and activates the Toll-like receptor 8 (TLR8), a key component of the innate immune system. TLR8 plays a crucial role in recognizing pathogens and initiating immune responses by activating downstream signaling pathways. By stimulating TLR8, Agonist 5 enhances the production of pro-inflammatory cytokines and improves immune surveillance. This makes it a promising candidate for boosting immune responses in conditions such as infections, cancer, and autoimmune diseases. Researchers are investigating its potential to enhance the effectiveness of immunotherapies and vaccines.
| CAS Number | 2413016-41-6 |
| Synonyms | benzyl N-[1-[2-[1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylamino]-2-methyl-1-oxopropan-2-yl]carbamate |
| Molecular Formula | C31H40N6O5 |
| Purity | ≥95% |
| IUPAC Name | benzyl N-[1-[2-[1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl]oxyethylamino]-2-methyl-1-oxopropan-2-yl]carbamate |
| InChI | InChI=1S/C31H40N6O5/c1-6-40-19-24-35-25-26(22-14-10-11-15-23(22)34-27(25)32)37(24)20-30(2,3)42-17-16-33-28(38)31(4,5)36-29(39)41-18-21-12-8-7-9-13-21/h7-15H,6,16-20H2,1-5H3,(H2,32,34)(H,33,38)(H,36,39) |
| InChIKey | UXDUNZGDEXDOEZ-UHFFFAOYSA-N |
| SMILES | CCOCC1=NC2=C(N1CC(C)(C)OCCNC(=O)C(C)(C)NC(=O)OCC3=CC=CC=C3)C4=CC=CC=C4N=C2N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
