For research use only. Not for therapeutic Use.
TMB is an aromatic amine that undergoes oxidation by the higher oxidation states of heme peroxidases (compounds I and II) thereby serving as a reducing co-<wbr></wbr>substrate. One electron oxidation of TMB results in a radical cation that forms a charge-<wbr></wbr>transfer complex with the unoxidized compound. This charge transfer complex absorbs at 652 nm (ε = 39,000). The completely oxidized form (diimine) absorbs at 450 nm (ε = 59,000) and is formed by two sequential one-<wbr></wbr>electron oxidations of TMB. Thus the stoichiometry of oxidation is 0.5 mole charge transfer complex (λ<sub>max</sub> = 652 nm) or 1 mole of diimine (λ<sub>max</sub> = 450 nm) formed (or TMB oxidized) per mole of hydroperoxide reduced by the peroxidase.
| Catalog Number | R067350 |
| CAS Number | 207738-08-7 |
| Synonyms | 3,3/’,5,5/’-tetramethyl-[1,1/’-biphenyl]-4,4/’-diamine, dihydrochloride, dihydrate |
| Molecular Formula | C16H20N2 • 2HCl [2H2O] |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C16H20N2.2ClH.2H2O/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14;;;;/h5-8H,17-18H2,1-4H3;2*1H;2*1H2 |
| InChIKey | CJRXJBONCVPXPJ-UHFFFAOYSA-N |
| SMILES | CC1=C(N)C(C)=CC(C2=CC(C)=C(N)C(C)=C2)=C1.Cl.Cl.O.O |
| Reference | 1.Josephy, P.D.,Eling, T., and Mason, R.P. The horseradish peroxidase-catalyzed oxidation of 3,5,3/’,5/’-tetramethylbenzidine. Free radical and charge-transfer complex intermediates. The Journal of Biological Chemisty 257, 3669-3675 (1982). |
