For research use only. Not for therapeutic Use.
TMC353121（Cat No.:I005147）is a potent, selective inhibitor of the hepatitis C virus (HCV) NS5A protein, which plays a critical role in viral replication and assembly. This compound has demonstrated strong antiviral activity against multiple HCV genotypes, particularly against drug-resistant strains. TMC353121 effectively disrupts the replication process, inhibiting the formation of viral particles. It is often studied in combination with other antiviral agents as part of direct-acting antiviral (DAA) regimens for treating chronic HCV infections. Its clinical development focuses on improving cure rates and reducing treatment duration.
| Catalog Number | I005147 |
| CAS Number | 857066-90-1 |
| Synonyms | 2-[[6-[[2-(3-hydroxypropyl)-5-methylanilino]methyl]-2-(3-morpholin-4-ylpropylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-olTMC353121; TMC353121 |
| Molecular Formula | C32H42N6O3 |
| Purity | ≥95% |
| Target | RSV |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| Overview of Clinical Research | TMC353121 is a viral fusion protein inhibitors developed by Johnson&Johnson Pharmaceutical Research&Development. |
| IC50 | 9.9(pEC50) |
| IUPAC Name | 2-[[6-[[2-(3-hydroxypropyl)-5-methylanilino]methyl]-2-(3-morpholin-4-ylpropylamino)benzimidazol-1-yl]methyl]-6-methylpyridin-3-ol |
| InChI | InChI=1S/C32H42N6O3/c1-23-6-9-26(5-3-16-39)28(19-23)34-21-25-8-10-27-30(20-25)38(22-29-31(40)11-7-24(2)35-29)32(36-27)33-12-4-13-37-14-17-41-18-15-37/h6-11,19-20,34,39-40H,3-5,12-18,21-22H2,1-2H3,(H,33,36) |
| InChIKey | DKORMNNYNRPTBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CCCO)NCC2=CC3=C(C=C2)N=C(N3CC4=C(C=CC(=N4)C)O)NCCCN5CCOCC5 |
| Reference | <br /> |
