For research use only. Not for therapeutic Use.
Potent non-competitive antagonist of neuronal nicotinic ACh receptors (nAChRs). Produces long-lasting inhibition of neuronal nAChRs formed by the combination of the most abundant <span class=/’symbol/’>α</span> and <span class=/’symbol/’>β</span> subunits (i.e. <span class=/’symbol/’>α</span>3, <span class=/’symbol/’>α</span>4 and <span class=/’symbol/’>β</span>2, <span class=/’symbol/’>β</span>4 respectively). Displays little inhibition of muscle-type (<span class=/’symbol/’>α</span>1<span class=/’symbol/’>β</span>1<span class=/’symbol/’>γ</span><span class=/’symbol/’>δ</span>) or <span class=/’symbol/’>α</span>7 receptors.
| Catalog Number | I010553 |
| CAS Number | 849461-91-2 |
| Synonyms | 2,2,6,6-Tetramethylpiperidin-4-yl heptanoate |
| Molecular Formula | C16H32ClNO2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
| Storage | Desiccate at RT |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) heptanoate;hydrochloride |
| InChI | InChI=1S/C16H31NO2.ClH/c1-6-7-8-9-10-14(18)19-13-11-15(2,3)17-16(4,5)12-13;/h13,17H,6-12H2,1-5H3;1H |
| InChIKey | XIDDVJIJIFWGIX-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)OC1CC(NC(C1)(C)C)(C)C.Cl |
