For research use only. Not for therapeutic Use.
TMX1 is a BRD4 covalent molecular glue degrader. TMX1 selectively recruits DCAF16 to BRD4BD2, resulting in the degradation of BRD4[1].
| Catalog Number | I041364 |
| Synonyms | tert-butyl 2-[(9S)-4,5,13-trimethyl-7-[4-[(E)-3-oxoprop-1-enyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
| Molecular Formula | C26H28N4O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C26H28N4O3S/c1-15-16(2)34-25-22(15)23(19-11-9-18(10-12-19)8-7-13-31)27-20(14-21(32)33-26(4,5)6)24-29-28-17(3)30(24)25/h7-13,20H,14H2,1-6H3/b8-7+/t20-/m0/s1 |
| InChIKey | SJISOGWQGIVAGX-DUIUGDAFSA-N |
| SMILES | CC1=C(SC2=C1C(=NC(C3=NN=C(N32)C)CC(=O)OC(C)(C)C)C4=CC=C(C=C4)C=CC=O)C |
| Reference | [1]. Li Y D, et al. Template-assisted covalent modification of DCAF16 enables BRD4 molecular glue degraders[J]. Cancer Research, 2023, 83(7_Supplement): 3424-3424. |
