For research use only. Not for therapeutic Use.
TMX1 (Cat No.:I041364) is a protein involved in regulating oxidative stress and maintaining cellular redox balance. It functions within the endoplasmic reticulum and interacts with thioredoxin systems to control the oxidation states of other proteins. TMX1 is studied for its potential role in various diseases, including cancer, neurodegenerative disorders, and cardiovascular diseases, where oxidative stress is a contributing factor. Research into TMX1 focuses on understanding its molecular mechanisms and potential therapeutic applications, including the development of drugs that modulate its activity to treat diseases associated with oxidative damage and inflammation.
CAS Number | 54965-24-1 |
Synonyms | tert-butyl 2-[(9S)-4,5,13-trimethyl-7-[4-[(E)-3-oxoprop-1-enyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
Molecular Formula | C26H28N4O3S |
Purity | ≥95% |
IUPAC Name | tert-butyl 2-[(9S)-4,5,13-trimethyl-7-[4-[(E)-3-oxoprop-1-enyl]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetate |
InChI | InChI=1S/C26H28N4O3S/c1-15-16(2)34-25-22(15)23(19-11-9-18(10-12-19)8-7-13-31)27-20(14-21(32)33-26(4,5)6)24-29-28-17(3)30(24)25/h7-13,20H,14H2,1-6H3/b8-7+/t20-/m0/s1 |
InChIKey | SJISOGWQGIVAGX-DUIUGDAFSA-N |
SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)OC(C)(C)C)C4=CC=C(C=C4)/C=C/C=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |