For research use only. Not for therapeutic Use.
TNP 470 (CAT: I011402) is an analog of Fumagillin that exhibits strong antiangiogenic properties in vitro studies. Angiogenesis, the formation of new blood vessels from pre-existing ones, plays a crucial role in various physiological and pathological processes, including tumor growth and metastasis. TNP 470 works by inhibiting the growth of blood vessels, thereby restricting the blood supply to tumors and preventing their progression. Its potent antiangiogenic activity has made it a subject of interest in cancer research, as it offers potential for the development of anti-cancer therapies focused on targeting angiogenesis.
| Catalog Number | I011402 |
| CAS Number | 129298-91-5 |
| Synonyms | N-(2-Chloroacetyl)-carbamic Acid (3R,4S,5S,6R)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-1-oxaspiro[2.5]oct-6-yl Ester; (Chloroacetyl)-carbamic Acid (3R,4S,5S,6R)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-butenyl)oxiranyl] |
| Molecular Formula | C19H28ClNO6 |
| Purity | ≥95% |
| Target | Aminopeptidase |
| Solubility | Soluble in DMSO |
| Storage | Room temperature |
| InChIKey | MSHZHSPISPJWHW-PVDLLORBSA-N |
| SMILES | O=C(NC(CCl)=O)O[C@@H]1CC[C@@]2(OC2)[C@]([C@](O3)(C)[C@H]3C/C=C(C)/C)([H])[C@@H]1OC |
| Reference | 1: Kidoikhammouan S, Seubwai W, Tantapotinan N, Silsirivanit A, Wongkham S, |
