For research use only. Not for therapeutic Use.
Tobramycin（Cat No.:I003180）is an aminoglycoside antibiotic widely used to treat serious infections caused by gram-negative bacteria, including Pseudomonas aeruginosa. It works by binding to the 30S ribosomal subunit, disrupting protein synthesis and leading to bacterial cell death. Commonly used for respiratory, urinary tract, and eye infections, Tobramycin is also valuable in cystic fibrosis treatment due to its efficacy against lung infections. In research, it aids studies on antibiotic resistance, protein synthesis inhibition, and drug delivery. Its potency and targeted action make it essential in managing challenging bacterial infections.
| Catalog Number | I003180 |
| CAS Number | 32986-56-4 |
| Synonyms | Deoxykanamycin B;Distobram;Gernebcin;NSC 180514 |
| Molecular Formula | C18H37N5O9 |
| Purity | ≥95% |
| Documentation | |
| Target | Bacterial |
| Solubility | H2O: 97 mg/mL, DMSO: ＜1 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | (2S,3R,4S,5S,6R)-4-amino-2-[(1S,2S,3R,4S,6R)-4,6-diamino-3-[(2R,3R,5S,6R)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxane-3,5-diol |
| InChI | InChI=1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | NLVFBUXFDBBNBW-PBSUHMDJSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H](C[C@@H]([C@H](O3)CN)O)N)N |
| Reference | <p style=/line-height:25px/> |
