For research use only. Not for therapeutic Use.
Tolbutamide( Cat No.: I004440) is a first-generation sulfonylurea antidiabetic drug used primarily in research related to type 2 diabetes mellitus. It works by stimulating insulin secretion from pancreatic beta cells, thereby lowering blood glucose levels. Tolbutamide is particularly valuable in studying insulin release mechanisms and pancreatic function. Its short half-life and well-characterized pharmacokinetics make it an ideal compound for metabolic research. Additionally, tolbutamide serves as a reference compound in evaluating newer antidiabetic therapies, offering insights into glucose regulation and beta-cell responsiveness.
CAS Number | 64-77-7 |
Synonyms | 1-butyl-3-(4-methylphenyl)sulfonylurea |
Molecular Formula | C12H18N2O3S |
Purity | ≥95% |
Target | Na+/K+ ATPase |
Solubility | DMSO: ≥ 34 mg/mL |
Storage | store at -20℃ |
IUPAC Name | 1-butyl-3-(4-methylphenyl)sulfonylurea |
InChI | 1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
InChIKey | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
SMILES | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |