For research use only. Not for therapeutic Use.
Tolclofos-methyl（Cat No.:I004126）is a broad-spectrum fungicide belonging to the organophosphorus class, commonly used in agriculture to protect crops from soil-borne fungal diseases. Effective against pathogens like Rhizoctonia solani, it is often applied to vegetables, cereals, and ornamental plants to prevent root and stem rots. Tolclofos-methyl works by disrupting fungal cell membranes, leading to inhibited growth and infection control. Known for its stability and lasting efficacy in soil, it is a valuable agent in integrated pest management. Its role in agricultural productivity makes it essential for sustainable crop protection.
| Catalog Number | I004126 |
| CAS Number | 57018-04-9 |
| Molecular Formula | C9H11Cl2O3PS |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | DMSO:36mg/mL |
| Storage | Store at -20℃ |
| IUPAC Name | (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane |
| InChI | InChI=1S/C9H11Cl2O3PS/c1-6-4-7(10)9(8(11)5-6)14-15(16,12-2)13-3/h4-5H,1-3H3 |
| InChIKey | OBZIQQJJIKNWNO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)OP(=S)(OC)OC)Cl |
| Reference | <p style=/line-height:25px/> |
