For research use only. Not for therapeutic Use.
Toll-like receptor (TLR) modulators(Cat No.:I005514)are compounds designed to regulate the activity of Toll-like receptors, which play a crucial role in the immune system’s response to pathogens. TLRs are involved in detecting microbial patterns and initiating immune responses, but their overactivation can contribute to inflammatory diseases. TLR modulators can either enhance or inhibit TLR activity, depending on the therapeutic need. These modulators show potential in treating a variety of conditions, including autoimmune diseases, infections, and cancer. Ongoing research aims to develop selective TLR modulators to control immune responses safely and effectively.
CAS Number | 926927-42-6 |
Synonyms | ethyl 2-amino-8-(1,1,2,2,2-pentafluoroethyl)-3H-1-benzazepine-4-carboxylate |
Molecular Formula | C15H13F5N2O2 |
Purity | ≥95% |
Target | Toll-like Receptor (TLR) |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | ethyl 2-amino-8-(1,1,2,2,2-pentafluoroethyl)-3H-1-benzazepine-4-carboxylate |
InChI | InChI=1S/C15H13F5N2O2/c1-2-24-13(23)9-5-8-3-4-10(14(16,17)15(18,19)20)7-11(8)22-12(21)6-9/h3-5,7H,2,6H2,1H3,(H2,21,22) |
InChIKey | ICZPANLPYRTVSF-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(C=C(C=C2)C(C(F)(F)F)(F)F)N=C(C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |