Tolnaftate（Cat No.:A000494）is an antifungal medication used to treat skin infections caused by fungi, such as athlete’s foot, jock itch, and ringworm. It works by inhibiting the growth of dermatophytes, the fungi responsible for these infections, by interfering with their cell membrane synthesis. Tolnaftate is available in various topical forms, including creams, powders, sprays, and solutions, offering flexible application options. Known for its effectiveness and minimal side effects, Tolnaftate relieves symptoms like itching, burning, and scaling, promoting healing and preventing recurrence of superficial fungal infections. Its accessibility makes it a popular choice for over-the-counter treatment.
| Catalog Number | A000494 |
| CAS Number | 2398-96-1 |
| Synonyms | 2398-96-1; Tolnaphthate; Tinactin; Tonoftal; Aftate |
| Molecular Formula | C19H17NOS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | O-naphthalen-2-yl N-methyl-N-(3-methylphenyl)carbamothioate |
| InChI | InChI=1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3 |
| InChIKey | FUSNMLFNXJSCDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C)C(=S)OC2=CC3=CC=CC=C3C=C2 |
