For research use only. Not for therapeutic Use.
Toltrazuril（Cat No.:A000564）is a broad-spectrum anticoccidial agent used in veterinary medicine to treat coccidiosis caused by Eimeria species in poultry, livestock, and other animals. It targets multiple stages of the parasite’s life cycle, including schizogony and gametogony, by disrupting mitochondrial function and energy metabolism, leading to parasite death. Toltrazuril is administered orally and is highly effective with minimal resistance issues. Its long-acting properties provide prolonged protection, reducing the risk of reinfection. Toltrazuril supports animal health and productivity, making it a vital component in parasite control programs in agriculture.
| Catalog Number | A000564 |
| CAS Number | 69004-03-1 |
| Synonyms | NA |
| Molecular Formula | C18H14F3N3O4S |
| Purity | ≥95% |
| Target | Parasite |
| Solubility | >18.1mg/mL in DMSO |
| Storage | 3 years -20℃ powder |
| IUPAC Name | 1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione |
| InChI | InChI=1S/C18H14F3N3O4S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)28-12-4-6-13(7-5-12)29-18(19,20)21/h3-9H,1-2H3,(H,22,25,26) |
| InChIKey | OCINXEZVIIVXFU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C)OC3=CC=C(C=C3)SC(F)(F)F |
