Toltrazuril (Cat.No:A000564) is a veterinary drug used to treat parasitic infections in animals, particularly coccidiosis. It belongs to the triazinone class of compounds and acts by disrupting the parasite’s ability to reproduce and multiply. Toltrazuril is widely employed in animal husbandry to prevent and manage protozoal infections, ensuring animal health.
| Catalog Number | A000564 |
| CAS Number | 69004-03-1 |
| Synonyms | NA |
| Molecular Formula | C18H14F3N3O4S |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | >18.1mg/mL in DMSO |
| Storage | 3 years -20℃ powder |
| IUPAC Name | 1-methyl-3-[3-methyl-4-[4-(trifluoromethylsulfanyl)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione |
| InChI | 1S/C18H14F3N3O4S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)28-12-4-6-13(7-5-12)29-18(19,20)21/h3-9H,1-2H3,(H,22,25,26) |
| InChIKey | OCINXEZVIIVXFU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C)OC3=CC=C(C=C3)SC(F)(F)F |
