For research use only. Not for therapeutic Use.
Toluene-d5(Cat No.:R023968)is a high-purity, deuterated solvent crucial for advanced chemical and pharmaceutical research. This isotopically labeled version of toluene, with five deuterium atoms, is essential for studies involving reaction mechanisms, solvent effects, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, Toluene-d5 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations and the development of innovative chemical processes and products.
CAS Number | 1603-99-2 |
Synonyms | 1-Methylbenzene; Antisal 1a; CP 25; CP 25 (solvent); Methacide; Methylbenzene; Methylbenzol; NSC 406333; Phenylmethane; Tolu |
Molecular Formula | C7H8 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5-pentadeuterio-6-methylbenzene |
InChI | InChI=1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i2D,3D,4D,5D,6D |
InChIKey | YXFVVABEGXRONW-VIQYUKPQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C)[2H])[2H] |